Products 2995272-58-5
CAS 2995272-58-5 is the registry number for 2-(2,6-Dioxopiperidin-3-yl)-1,3-dioxoisoindolin-4-yl acrylate, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl] prop-2-enoate (CAS 2995272-58-5) is a chemical compound with the molecular formula C16H12N2O6 and a molecular weight of 328.28 g/mol. IUPAC name: [2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl] prop-2-enoate. InChIKey: PIAJEGZPKXACQH-UHFFFAOYSA-N.
| Molecular formula | C16H12N2O6 |
|---|---|
| Molecular weight | 328.28 g/mol |
| IUPAC name | [2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl] prop-2-enoate |
| InChIKey | PIAJEGZPKXACQH-UHFFFAOYSA-N |
| SMILES | C=CC(=O)OC1=CC=CC2=C1C(=O)N(C2=O)C3CCC(=O)NC3=O |
Computed by PubChem (NCBI)