Products 91574-36-6
CAS 91574-36-6 is the registry number for 3-Mal-MBz-NHS. Offered by: Iris Biotech. Available pack sizes: 100mg, 250mg.
(2,5-dioxopyrrolidin-1-yl) 3-[(2,5-dioxopyrrol-1-yl)methyl]benzoate (CAS 91574-36-6) is a chemical compound with the molecular formula C16H12N2O6 and a molecular weight of 328.28 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[(2,5-dioxopyrrol-1-yl)methyl]benzoate. InChIKey: JDYCJAOVESERHZ-UHFFFAOYSA-N.
| Molecular formula | C16H12N2O6 |
|---|---|
| Molecular weight | 328.28 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[(2,5-dioxopyrrol-1-yl)methyl]benzoate |
| InChIKey | JDYCJAOVESERHZ-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)C2=CC=CC(=C2)CN3C(=O)C=CC3=O |
Computed by PubChem (NCBI)