Products 2230179-50-5
CAS 2230179-50-5 is the registry number for 2-Ethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde, 98%, 98%. Offered by: Chemat. Available pack sizes: 50mg, 100mg.
2-ethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde (CAS 2230179-50-5) is a chemical compound with the molecular formula C15H21BO4 and a molecular weight of 276.14 g/mol. IUPAC name: 2-ethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde. InChIKey: NAMVBKSIJPSIST-UHFFFAOYSA-N.
| Molecular formula | C15H21BO4 |
|---|---|
| Molecular weight | 276.14 g/mol |
| IUPAC name | 2-ethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde |
| InChIKey | NAMVBKSIJPSIST-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)OCC)C=O |
Computed by PubChem (NCBI)