Products 2230789-60-1
CAS 2230789-60-1 is the registry number for tert-Butyl (3R)-3-tert-butyl-1,2,3,4-tetrahydroquinoxaline-1-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Tert-butyl (3R)-3-tert-butyl-3,4-dihydro-2H-quinoxaline-1-carboxylate (CAS 2230789-60-1) is a chemical compound with the molecular formula C17H26N2O2 and a molecular weight of 290.4 g/mol. IUPAC name: tert-butyl (3R)-3-tert-butyl-3,4-dihydro-2H-quinoxaline-1-carboxylate. InChIKey: LZNWEJWOHPBKLN-AWEZNQCLSA-N.
| Molecular formula | C17H26N2O2 |
|---|---|
| Molecular weight | 290.4 g/mol |
| IUPAC name | tert-butyl (3R)-3-tert-butyl-3,4-dihydro-2H-quinoxaline-1-carboxylate |
| InChIKey | LZNWEJWOHPBKLN-AWEZNQCLSA-N |
| SMILES | CC(C)(C)[C@@H]1CN(C2=CC=CC=C2N1)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)