Products 2230802-83-0
CAS 2230802-83-0 is the registry number for rac-(1R,5R)-3-Azabicyclo(3.2.0)heptane-1-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(1R,5R)-3-azabicyclo[3.2.0]heptane-1-carboxylic acid;hydrochloride (CAS 2230802-83-0) is a chemical compound with the molecular formula C7H12ClNO2 and a molecular weight of 177.63 g/mol. IUPAC name: (1R,5R)-3-azabicyclo[3.2.0]heptane-1-carboxylic acid;hydrochloride. InChIKey: BMMUJLSVMRSEKW-KQBMADMWSA-N.
| Molecular formula | C7H12ClNO2 |
|---|---|
| Molecular weight | 177.63 g/mol |
| IUPAC name | (1R,5R)-3-azabicyclo[3.2.0]heptane-1-carboxylic acid;hydrochloride |
| InChIKey | BMMUJLSVMRSEKW-KQBMADMWSA-N |
| SMILES | C1C[C@]2([C@@H]1CNC2)C(=O)O.Cl |
Computed by PubChem (NCBI)