Products 2230807-50-6
CAS 2230807-50-6 is the registry number for rac-(1R,5S,6R)-6-Amino-2-oxabicyclo(3.2.0)heptan-3-one hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(1R,5S,6R)-6-amino-2-oxabicyclo[3.2.0]heptan-3-one;hydrochloride (CAS 2230807-50-6) is a chemical compound with the molecular formula C6H10ClNO2 and a molecular weight of 163.60 g/mol. IUPAC name: (1R,5S,6R)-6-amino-2-oxabicyclo[3.2.0]heptan-3-one;hydrochloride. InChIKey: GSZYRDVFZAMVKP-UJPDDDSFSA-N.
| Molecular formula | C6H10ClNO2 |
|---|---|
| Molecular weight | 163.60 g/mol |
| IUPAC name | (1R,5S,6R)-6-amino-2-oxabicyclo[3.2.0]heptan-3-one;hydrochloride |
| InChIKey | GSZYRDVFZAMVKP-UJPDDDSFSA-N |
| SMILES | C1[C@H]([C@H]2[C@@H]1OC(=O)C2)N.Cl |
Computed by PubChem (NCBI)