Products 2230885-89-7
CAS 2230885-89-7 is the registry number for N-([1,1':4',1''-Terphenyl]-2-yl)-9,9-dimethyl-9H-fluoren-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
9,9-dimethyl-N-[2-(4-phenylphenyl)phenyl]fluoren-2-amine (CAS 2230885-89-7) is a chemical compound with the molecular formula C33H27N and a molecular weight of 437.6 g/mol. IUPAC name: 9,9-dimethyl-N-[2-(4-phenylphenyl)phenyl]fluoren-2-amine. InChIKey: KQHZKQYMAOVVJN-UHFFFAOYSA-N.
| Molecular formula | C33H27N |
|---|---|
| Molecular weight | 437.6 g/mol |
| IUPAC name | 9,9-dimethyl-N-[2-(4-phenylphenyl)phenyl]fluoren-2-amine |
| InChIKey | KQHZKQYMAOVVJN-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC=CC=C2C3=C1C=C(C=C3)NC4=CC=CC=C4C5=CC=C(C=C5)C6=CC=CC=C6)C |
Computed by PubChem (NCBI)