CAS 1609484-31-2 is the registry number for N-([1,1':3',1''-Terphenyl]-4'-yl)-9,9-dimethyl-9H-fluoren-2-amine, 98%, 98%. Offered by: Chemat. Available pack sizes: 250mg, 1g.
N-(2,4-diphenylphenyl)-9,9-dimethylfluoren-2-amine (CAS 1609484-31-2) is a chemical compound with the molecular formula C33H27N and a molecular weight of 437.6 g/mol. IUPAC name: N-(2,4-diphenylphenyl)-9,9-dimethylfluoren-2-amine. InChIKey: SSIWNBKHUVTFHG-UHFFFAOYSA-N.
| Molecular formula | C33H27N |
|---|---|
| Molecular weight | 437.6 g/mol |
| IUPAC name | N-(2,4-diphenylphenyl)-9,9-dimethylfluoren-2-amine |
| InChIKey | SSIWNBKHUVTFHG-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC=CC=C2C3=C1C=C(C=C3)NC4=C(C=C(C=C4)C5=CC=CC=C5)C6=CC=CC=C6)C |
Computed by PubChem (NCBI)