Products 2260615-69-6
CAS 2260615-69-6 is the registry number for 9,9-Dimethyl-N-[1,1′:2′,1′′-terphenyl]-4-yl-9H-fluoren-2-amine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
9,9-dimethyl-N-[4-(2-phenylphenyl)phenyl]fluoren-2-amine (CAS 2260615-69-6) is a chemical compound with the molecular formula C33H27N and a molecular weight of 437.6 g/mol. IUPAC name: 9,9-dimethyl-N-[4-(2-phenylphenyl)phenyl]fluoren-2-amine. InChIKey: GCWYVJCARBGBGD-UHFFFAOYSA-N.
| Molecular formula | C33H27N |
|---|---|
| Molecular weight | 437.6 g/mol |
| IUPAC name | 9,9-dimethyl-N-[4-(2-phenylphenyl)phenyl]fluoren-2-amine |
| InChIKey | GCWYVJCARBGBGD-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC=CC=C2C3=C1C=C(C=C3)NC4=CC=C(C=C4)C5=CC=CC=C5C6=CC=CC=C6)C |
Computed by PubChem (NCBI)