CAS 1267247-99-3 is the registry number for N-(4-(9,9-Dimethyl-9H-fluoren-2-yl)phenyl)-[1,1'-biphenyl]-4-amine, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
N-[4-(9,9-dimethylfluoren-2-yl)phenyl]-4-phenylaniline (CAS 1267247-99-3) is a chemical compound with the molecular formula C33H27N and a molecular weight of 437.6 g/mol. IUPAC name: N-[4-(9,9-dimethylfluoren-2-yl)phenyl]-4-phenylaniline. InChIKey: YAFZRDRWOQRUIP-UHFFFAOYSA-N.
| Molecular formula | C33H27N |
|---|---|
| Molecular weight | 437.6 g/mol |
| IUPAC name | N-[4-(9,9-dimethylfluoren-2-yl)phenyl]-4-phenylaniline |
| InChIKey | YAFZRDRWOQRUIP-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC=CC=C2C3=C1C=C(C=C3)C4=CC=C(C=C4)NC5=CC=C(C=C5)C6=CC=CC=C6)C |
Computed by PubChem (NCBI)