CAS 2230913-59-2 is the registry number for tert-Butyl trans-3-amino-4-methylpyrrolidine-1-carboxylate hydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Tert-butyl (3R,4S)-3-amino-4-methylpyrrolidine-1-carboxylate;hydrochloride (CAS 2230913-59-2) is a chemical compound with the molecular formula C10H21ClN2O2 and a molecular weight of 236.74 g/mol. IUPAC name: tert-butyl (3R,4S)-3-amino-4-methylpyrrolidine-1-carboxylate;hydrochloride. InChIKey: IXBLNFDWECFVSM-WSZWBAFRSA-N.
| Molecular formula | C10H21ClN2O2 |
|---|---|
| Molecular weight | 236.74 g/mol |
| IUPAC name | tert-butyl (3R,4S)-3-amino-4-methylpyrrolidine-1-carboxylate;hydrochloride |
| InChIKey | IXBLNFDWECFVSM-WSZWBAFRSA-N |
| SMILES | C[C@H]1CN(C[C@@H]1N)C(=O)OC(C)(C)C.Cl |
Computed by PubChem (NCBI)