CAS 223134-73-4 appears in our catalog under these names: Flutamide Impurity 7-d6, Hydroxy Flutamide-d6. Offered by: Hubei YoungXin, TRC, Biosynth. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 2,5mg.
3,3,3-trideuterio-2-hydroxy-N-[4-nitro-3-(trifluoromethyl)phenyl]-2-(trideuteriomethyl)propanamide (CAS 223134-73-4) is a chemical compound with the molecular formula C11H11F3N2O4 and a molecular weight of 298.25 g/mol. IUPAC name: 3,3,3-trideuterio-2-hydroxy-N-[4-nitro-3-(trifluoromethyl)phenyl]-2-(trideuteriomethyl)propanamide. InChIKey: YPQLFJODEKMJEF-WFGJKAKNSA-N.
| Molecular formula | C11H11F3N2O4 |
|---|---|
| Molecular weight | 298.25 g/mol |
| IUPAC name | 3,3,3-trideuterio-2-hydroxy-N-[4-nitro-3-(trifluoromethyl)phenyl]-2-(trideuteriomethyl)propanamide |
| InChIKey | YPQLFJODEKMJEF-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])C(C(=O)NC1=CC(=C(C=C1)[N+](=O)[O-])C(F)(F)F)(C([2H])([2H])[2H])O |
Computed by PubChem (NCBI)