CAS 52806-53-8 appears in our catalog under these names: Hydroxy Flutamide, Hydroxy Flutamide, >95% (HPLC), 2-Hydroxy-2-methyl-N-(4-nitro-3-(trifluoromethyl)phenyl)propanamide (2-Hydroxyflutamide), 2-hydroxy Flutamide/ 99.45% (existing batch purity), 2–hydroxy Flutamide. Offered by: Chemat Brand, TRC, Mikromol, TargetMol, GLPBio. Available pack sizes: on request, 10mg, 25mg, 5mg, 100mg, 50mg, 200mg, 250mg.
2-hydroxy-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]propanamide (CAS 52806-53-8) is a chemical compound with the molecular formula C11H11F3N2O4 and a molecular weight of 292.21 g/mol. IUPAC name: 2-hydroxy-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]propanamide. InChIKey: YPQLFJODEKMJEF-UHFFFAOYSA-N.
| Molecular formula | C11H11F3N2O4 |
|---|---|
| Molecular weight | 292.21 g/mol |
| IUPAC name | 2-hydroxy-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]propanamide |
| InChIKey | YPQLFJODEKMJEF-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)NC1=CC(=C(C=C1)[N+](=O)[O-])C(F)(F)F)O |
Computed by PubChem (NCBI)