Products 62100-51-0

CAS 62100-51-0 is the registry number for Flutamide Impurity 12. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

2-methyl-2-[4-nitro-3-(trifluoromethyl)phenoxy]propanamide (CAS 62100-51-0) is a chemical compound with the molecular formula C11H11F3N2O4 and a molecular weight of 292.21 g/mol. IUPAC name: 2-methyl-2-[4-nitro-3-(trifluoromethyl)phenoxy]propanamide. InChIKey: HGBUBSARDABSAB-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11F3N2O4
Molecular weight292.21 g/mol
IUPAC name2-methyl-2-[4-nitro-3-(trifluoromethyl)phenoxy]propanamide
InChIKeyHGBUBSARDABSAB-UHFFFAOYSA-N
SMILESCC(C)(C(=O)N)OC1=CC(=C(C=C1)[N+](=O)[O-])C(F)(F)F

Computed by PubChem (NCBI)