CAS 62100-51-0 is the registry number for Flutamide Impurity 12. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
2-methyl-2-[4-nitro-3-(trifluoromethyl)phenoxy]propanamide (CAS 62100-51-0) is a chemical compound with the molecular formula C11H11F3N2O4 and a molecular weight of 292.21 g/mol. IUPAC name: 2-methyl-2-[4-nitro-3-(trifluoromethyl)phenoxy]propanamide. InChIKey: HGBUBSARDABSAB-UHFFFAOYSA-N.
| Molecular formula | C11H11F3N2O4 |
|---|---|
| Molecular weight | 292.21 g/mol |
| IUPAC name | 2-methyl-2-[4-nitro-3-(trifluoromethyl)phenoxy]propanamide |
| InChIKey | HGBUBSARDABSAB-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)N)OC1=CC(=C(C=C1)[N+](=O)[O-])C(F)(F)F |
Computed by PubChem (NCBI)