Products 2231675-47-9
CAS 2231675-47-9 is the registry number for Benzyl (4-carbamoylbicyclo[2.1.1]hexan-1-yl)carbamate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Benzyl N-(4-carbamoyl-1-bicyclo[2.1.1]hexanyl)carbamate (CAS 2231675-47-9) is a chemical compound with the molecular formula C15H18N2O3 and a molecular weight of 274.31 g/mol. IUPAC name: benzyl N-(4-carbamoyl-1-bicyclo[2.1.1]hexanyl)carbamate. InChIKey: MUDMLQLNJUJLCB-UHFFFAOYSA-N.
| Molecular formula | C15H18N2O3 |
|---|---|
| Molecular weight | 274.31 g/mol |
| IUPAC name | benzyl N-(4-carbamoyl-1-bicyclo[2.1.1]hexanyl)carbamate |
| InChIKey | MUDMLQLNJUJLCB-UHFFFAOYSA-N |
| SMILES | C1CC2(CC1(C2)C(=O)N)NC(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)