CAS 2232-79-3 appears in our catalog under these names: 2,4-Dihydro-2,6-naphthyridine-1,3-dione, 98%, 2,4-Dihydro-2,6-naphthyridine-1,3-dione, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
4H-2,6-naphthyridine-1,3-dione (CAS 2232-79-3) is a chemical compound with the molecular formula C8H6N2O2 and a molecular weight of 162.15 g/mol. IUPAC name: 4H-2,6-naphthyridine-1,3-dione. InChIKey: FZEIFGXIEWUEHU-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2 |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | 4H-2,6-naphthyridine-1,3-dione |
| InChIKey | FZEIFGXIEWUEHU-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CN=C2)C(=O)NC1=O |
Computed by PubChem (NCBI)