Products 223268-67-5

CAS 223268-67-5 is the registry number for 2'',6''-Dimethoxy-(1,1',2',1'')terphenyl, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

1,3-dimethoxy-2-(2-phenylphenyl)benzene (CAS 223268-67-5) is a chemical compound with the molecular formula C20H18O2 and a molecular weight of 290.4 g/mol. IUPAC name: 1,3-dimethoxy-2-(2-phenylphenyl)benzene. InChIKey: MDUHNPYLBCLYBA-UHFFFAOYSA-N.

Identity
Molecular formulaC20H18O2
Molecular weight290.4 g/mol
IUPAC name1,3-dimethoxy-2-(2-phenylphenyl)benzene
InChIKeyMDUHNPYLBCLYBA-UHFFFAOYSA-N
SMILESCOC1=C(C(=CC=C1)OC)C2=CC=CC=C2C3=CC=CC=C3

Computed by PubChem (NCBI)