CAS 355803-76-8 is the registry number for 1,2-Diphenyl-1-(4-hydroxyphenyl)ethanol. Offered by: TRC. Available pack sizes: 100mg, 250mg, 500mg.
4-(1-hydroxy-1,2-diphenylethyl)phenol (CAS 355803-76-8) is a chemical compound with the molecular formula C20H18O2 and a molecular weight of 290.4 g/mol. IUPAC name: 4-(1-hydroxy-1,2-diphenylethyl)phenol. InChIKey: LQDKHIMEMDNRPO-UHFFFAOYSA-N.
| Molecular formula | C20H18O2 |
|---|---|
| Molecular weight | 290.4 g/mol |
| IUPAC name | 4-(1-hydroxy-1,2-diphenylethyl)phenol |
| InChIKey | LQDKHIMEMDNRPO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(C2=CC=CC=C2)(C3=CC=C(C=C3)O)O |
Computed by PubChem (NCBI)