Products 70017-24-2

CAS 70017-24-2 is the registry number for 2,2''-Dimethoxy-1,1':4',1''-terphenyl, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g, 50g, 100g, 200g.

Structural formula: {0} (CAS {1})

1,4-bis(2-methoxyphenyl)benzene (CAS 70017-24-2) is a chemical compound with the molecular formula C20H18O2 and a molecular weight of 290.4 g/mol. IUPAC name: 1,4-bis(2-methoxyphenyl)benzene. InChIKey: KUPVLZCOEWZHFP-UHFFFAOYSA-N.

Identity
Molecular formulaC20H18O2
Molecular weight290.4 g/mol
IUPAC name1,4-bis(2-methoxyphenyl)benzene
InChIKeyKUPVLZCOEWZHFP-UHFFFAOYSA-N
SMILESCOC1=CC=CC=C1C2=CC=C(C=C2)C3=CC=CC=C3OC

Computed by PubChem (NCBI)