Products 2233595-37-2
CAS 2233595-37-2 appears in our catalog under these names: B-(2-Fluoro-3-(methoxy-d3)phenyl)boronic Acid, B-[2-Fluoro-3-(methoxy-d3)phenyl]boronic Acid. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, 25mg, 50mg, 10 mg, 5 mg, 50 mg, 100 mg, 25 mg.
[2-fluoro-3-(trideuteriomethoxy)phenyl]boronic acid (CAS 2233595-37-2) is a chemical compound with the molecular formula C7H8BFO3 and a molecular weight of 172.97 g/mol. IUPAC name: [2-fluoro-3-(trideuteriomethoxy)phenyl]boronic acid. InChIKey: JCKZNMSBFBPDPM-FIBGUPNXSA-N.
| Molecular formula | C7H8BFO3 |
|---|---|
| Molecular weight | 172.97 g/mol |
| IUPAC name | [2-fluoro-3-(trideuteriomethoxy)phenyl]boronic acid |
| InChIKey | JCKZNMSBFBPDPM-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OC1=CC=CC(=C1F)B(O)O |
Computed by PubChem (NCBI)