Products 2234286-28-1

CAS 2234286-28-1 is the registry number for Benzyl O-allyl-L-serinate hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

Benzyl (2S)-2-amino-3-prop-2-enoxypropanoate;hydrochloride (CAS 2234286-28-1) is a chemical compound with the molecular formula C13H18ClNO3 and a molecular weight of 271.74 g/mol. IUPAC name: benzyl (2S)-2-amino-3-prop-2-enoxypropanoate;hydrochloride. InChIKey: BDNJISUQFFXNPS-YDALLXLXSA-N.

Identity
Molecular formulaC13H18ClNO3
Molecular weight271.74 g/mol
IUPAC namebenzyl (2S)-2-amino-3-prop-2-enoxypropanoate;hydrochloride
InChIKeyBDNJISUQFFXNPS-YDALLXLXSA-N
SMILESC=CCOC[C@@H](C(=O)OCC1=CC=CC=C1)N.Cl

Computed by PubChem (NCBI)