Products 2235386-35-1
CAS 2235386-35-1 is the registry number for 3-Methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline, 97%, 97%. Offered by: Chemat. Available pack sizes: 50mg.
3-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline (CAS 2235386-35-1) is a chemical compound with the molecular formula C16H20BNO2 and a molecular weight of 269.1 g/mol. IUPAC name: 3-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline. InChIKey: OHRYKJXFCOZIEG-UHFFFAOYSA-N.
| Molecular formula | C16H20BNO2 |
|---|---|
| Molecular weight | 269.1 g/mol |
| IUPAC name | 3-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline |
| InChIKey | OHRYKJXFCOZIEG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)N=CC(=C3)C |
Computed by PubChem (NCBI)