CAS 2235395-02-3 is the registry number for 10-(4-Bromophenyl)-9,10-dihydroacridine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
10-(4-bromophenyl)-9H-acridine (CAS 2235395-02-3) is a chemical compound with the molecular formula C19H14BrN and a molecular weight of 336.2 g/mol. IUPAC name: 10-(4-bromophenyl)-9H-acridine. InChIKey: QSKVNLGQZGWDMR-UHFFFAOYSA-N.
| Molecular formula | C19H14BrN |
|---|---|
| Molecular weight | 336.2 g/mol |
| IUPAC name | 10-(4-bromophenyl)-9H-acridine |
| InChIKey | QSKVNLGQZGWDMR-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2N(C3=CC=CC=C31)C4=CC=C(C=C4)Br |
Computed by PubChem (NCBI)