CAS 251320-80-6 appears in our catalog under these names: Benzenamine, 2-bromo-n-(diphenylmethylene)-, 97%, N-(2-Bromophenyl)-1,1-diphenylmethanimine, 95-<97%, N-(2-Bromophenyl)-1,1-diphenylmethanimine, 98%. Offered by: Combi-blocks, Hoffman Fine Chemicals, AmBeed. Available pack sizes: 25g, 10g, 100g, 5g, 1g, 2,5g.
N-(2-bromophenyl)-1,1-diphenylmethanimine (CAS 251320-80-6) is a chemical compound with the molecular formula C19H14BrN and a molecular weight of 336.2 g/mol. IUPAC name: N-(2-bromophenyl)-1,1-diphenylmethanimine. InChIKey: CMZCISQJGBYLDE-UHFFFAOYSA-N.
| Molecular formula | C19H14BrN |
|---|---|
| Molecular weight | 336.2 g/mol |
| IUPAC name | N-(2-bromophenyl)-1,1-diphenylmethanimine |
| InChIKey | CMZCISQJGBYLDE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=NC2=CC=CC=C2Br)C3=CC=CC=C3 |
Computed by PubChem (NCBI)