CAS 890653-53-9 is the registry number for 3–Bromo–9–(m–tolyl)–9H–carbazole. Offered by: GLPBio. Available pack sizes: 200mg.
3-bromo-9-(3-methylphenyl)carbazole (CAS 890653-53-9) is a chemical compound with the molecular formula C19H14BrN and a molecular weight of 336.2 g/mol. IUPAC name: 3-bromo-9-(3-methylphenyl)carbazole. InChIKey: BTODXFDAJAELSC-UHFFFAOYSA-N.
| Molecular formula | C19H14BrN |
|---|---|
| Molecular weight | 336.2 g/mol |
| IUPAC name | 3-bromo-9-(3-methylphenyl)carbazole |
| InChIKey | BTODXFDAJAELSC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)N2C3=C(C=C(C=C3)Br)C4=CC=CC=C42 |
Computed by PubChem (NCBI)