Products 2237268-08-3
CAS 2237268-08-3 appears in our catalog under these names: 1-(4-((8-Oxa-3-azabicyclo[3.2.1]octan-3-yl)sulfonyl)phenyl)-3-(pyridin-4-ylmethyl)urea, SBI-797812/ 100%, SBI-797812, SBI-797812, 99.88%, SBI-797812, 98%. Offered by: Chemat, TargetMol, Biosynth, MedChemExpress, Ambeed. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 1mg, 200mg, 10 mg.
1-[4-(8-oxa-3-azabicyclo[3.2.1]octan-3-ylsulfonyl)phenyl]-3-(pyridin-4-ylmethyl)urea (CAS 2237268-08-3) is a chemical compound with the molecular formula C19H22N4O4S and a molecular weight of 402.5 g/mol. IUPAC name: 1-[4-(8-oxa-3-azabicyclo[3.2.1]octan-3-ylsulfonyl)phenyl]-3-(pyridin-4-ylmethyl)urea. InChIKey: KTSOHNHLOLGQCY-UHFFFAOYSA-N.
| Molecular formula | C19H22N4O4S |
|---|---|
| Molecular weight | 402.5 g/mol |
| IUPAC name | 1-[4-(8-oxa-3-azabicyclo[3.2.1]octan-3-ylsulfonyl)phenyl]-3-(pyridin-4-ylmethyl)urea |
| InChIKey | KTSOHNHLOLGQCY-UHFFFAOYSA-N |
| SMILES | C1CC2CN(CC1O2)S(=O)(=O)C3=CC=C(C=C3)NC(=O)NCC4=CC=NC=C4 |
Computed by PubChem (NCBI)
Synonyms:
orb1309119, s8980