CAS 89131-09-9 appears in our catalog under these names: Dabsyl-l-proline, 95%, Dabsyl–L–proline, Dabsyl-L-proline, ≥98%, ≥98%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 100mg, 10mg, 25mg.
(2S)-1-[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]sulfonylpyrrolidine-2-carboxylic acid (CAS 89131-09-9) is a chemical compound with the molecular formula C19H22N4O4S and a molecular weight of 402.5 g/mol. IUPAC name: (2S)-1-[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]sulfonylpyrrolidine-2-carboxylic acid. InChIKey: IIHLDMYXACDQGQ-SFHVURJKSA-N.
| Molecular formula | C19H22N4O4S |
|---|---|
| Molecular weight | 402.5 g/mol |
| IUPAC name | (2S)-1-[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]sulfonylpyrrolidine-2-carboxylic acid |
| InChIKey | IIHLDMYXACDQGQ-SFHVURJKSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)N=NC2=CC=C(C=C2)S(=O)(=O)N3CCC[C@H]3C(=O)O |
Computed by PubChem (NCBI)