CAS 2375541-28-7 is the registry number for Aster-A Ligand-3. Offered by: MedChemExpress. Available pack sizes: Get quote.
Tert-butyl 2-[(4-carbamoylbenzoyl)amino]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-5-carboxylate (CAS 2375541-28-7) is a chemical compound with the molecular formula C19H22N4O4S and a molecular weight of 402.5 g/mol. IUPAC name: tert-butyl 2-[(4-carbamoylbenzoyl)amino]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-5-carboxylate. InChIKey: CGVBNXBOCBXLJQ-UHFFFAOYSA-N.
| Molecular formula | C19H22N4O4S |
|---|---|
| Molecular weight | 402.5 g/mol |
| IUPAC name | tert-butyl 2-[(4-carbamoylbenzoyl)amino]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-5-carboxylate |
| InChIKey | CGVBNXBOCBXLJQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C(C1)SC(=N2)NC(=O)C3=CC=C(C=C3)C(=O)N |
Computed by PubChem (NCBI)