Products 2237297-00-4
CAS 2237297-00-4 is the registry number for AB–FUBINACA 2'–indazole isomer. Offered by: GLPBio. Available pack sizes: 1mg, 5mg.
N-[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]-2-[(4-fluorophenyl)methyl]indazole-3-carboxamide (CAS 2237297-00-4) is a chemical compound with the molecular formula C20H21FN4O2 and a molecular weight of 368.4 g/mol. IUPAC name: N-[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]-2-[(4-fluorophenyl)methyl]indazole-3-carboxamide. InChIKey: XFYTVZNCYIVYKQ-KRWDZBQOSA-N.
| Molecular formula | C20H21FN4O2 |
|---|---|
| Molecular weight | 368.4 g/mol |
| IUPAC name | N-[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]-2-[(4-fluorophenyl)methyl]indazole-3-carboxamide |
| InChIKey | XFYTVZNCYIVYKQ-KRWDZBQOSA-N |
| SMILES | CC(C)[C@@H](C(=O)N)NC(=O)C1=C2C=CC=CC2=NN1CC3=CC=C(C=C3)F |
Computed by PubChem (NCBI)
Synonyms:
AB-FUBINACA 2'-indazole isomer