Products 223786-53-6
CAS 223786-53-6 appears in our catalog under these names: 1-(4-Nitrophenyl)piperidine-4-carboxylic acid, 97%, 1-(4-Nitrophenyl)piperidine-4-carboxylic acid, 98%, 1-(4-Nitrophenyl)-4-piperidinecarboxylic acid, 1-(4-Nitrophenyl)piperidine-4-carboxylic acid, 95%, 95%, N-(4-Nitrophenyl)piperidine-4-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 100mg, 250mg.
1-(4-nitrophenyl)piperidine-4-carboxylic acid (CAS 223786-53-6) is a chemical compound with the molecular formula C12H14N2O4 and a molecular weight of 250.25 g/mol. IUPAC name: 1-(4-nitrophenyl)piperidine-4-carboxylic acid. InChIKey: ZIRBMAVPCZUDTF-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O4 |
|---|---|
| Molecular weight | 250.25 g/mol |
| IUPAC name | 1-(4-nitrophenyl)piperidine-4-carboxylic acid |
| InChIKey | ZIRBMAVPCZUDTF-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1C(=O)O)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)