Products 438192-02-0
CAS 438192-02-0 appears in our catalog under these names: 1-(2-Nitrophenyl)piperidine-4-carboxylic acid, 95%, 1-(2-Nitrophenyl)piperidine-4-carboxylic acid, N-(2-Nitrophenyl)piperidine-4-carboxylic acid, 97%. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 10g, 1g, 5g, 250mg, 500mg.
1-(2-nitrophenyl)piperidine-4-carboxylic acid (CAS 438192-02-0) is a chemical compound with the molecular formula C12H14N2O4 and a molecular weight of 250.25 g/mol. IUPAC name: 1-(2-nitrophenyl)piperidine-4-carboxylic acid. InChIKey: KFUXTZKDCWHNGQ-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O4 |
|---|---|
| Molecular weight | 250.25 g/mol |
| IUPAC name | 1-(2-nitrophenyl)piperidine-4-carboxylic acid |
| InChIKey | KFUXTZKDCWHNGQ-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1C(=O)O)C2=CC=CC=C2[N+](=O)[O-] |
Computed by PubChem (NCBI)