CAS 50508-34-4 is the registry number for 1-[(4-Nitrophenoxy)acetyl]pyrrolidine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 25g, 10g.
2-(4-nitrophenoxy)-1-pyrrolidin-1-ylethanone (CAS 50508-34-4) is a chemical compound with the molecular formula C12H14N2O4 and a molecular weight of 250.25 g/mol. IUPAC name: 2-(4-nitrophenoxy)-1-pyrrolidin-1-ylethanone. InChIKey: UQYFUARYMROWQH-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O4 |
|---|---|
| Molecular weight | 250.25 g/mol |
| IUPAC name | 2-(4-nitrophenoxy)-1-pyrrolidin-1-ylethanone |
| InChIKey | UQYFUARYMROWQH-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C(=O)COC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)