Products 2238852-65-6
CAS 2238852-65-6 is the registry number for STAADIUMâ„¢ PeptiZide L-Pyr. Offered by: Biosynth. Available pack sizes: 1g, 2,5g.
(2S)-N-[4-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]phenyl]-5-oxopyrrolidine-2-carboxamide (CAS 2238852-65-6) is a chemical compound with the molecular formula C17H17N3O3S and a molecular weight of 343.4 g/mol. IUPAC name: (2S)-N-[4-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]phenyl]-5-oxopyrrolidine-2-carboxamide. InChIKey: VFBXMKSONJCWMW-AWEZNQCLSA-N.
| Molecular formula | C17H17N3O3S |
|---|---|
| Molecular weight | 343.4 g/mol |
| IUPAC name | (2S)-N-[4-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]phenyl]-5-oxopyrrolidine-2-carboxamide |
| InChIKey | VFBXMKSONJCWMW-AWEZNQCLSA-N |
| SMILES | C1CC(=O)N[C@@H]1C(=O)NC2=CC=C(C=C2)CSC3=CC=CC=[N+]3[O-] |
Computed by PubChem (NCBI)
Synonyms:
STAADIUMtrade mark PeptiZide L-Pyr