Products 2920574-16-7
CAS 2920574-16-7 appears in our catalog under these names: SARS–CoV–2 nsp14–IN–3, SARS-CoV-2 nsp14-IN-3, 95%, 95%, SARS-CoV-2 nsp14-IN-3, 95.0%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 50 mg, 25 mg, 10 mg, 5 mg, 100 mg.
5-formyl-4-methyl-N-[2-methyl-3-(2-oxoimidazolidin-1-yl)phenyl]thiophene-2-carboxamide (CAS 2920574-16-7) is a chemical compound with the molecular formula C17H17N3O3S and a molecular weight of 343.4 g/mol. IUPAC name: 5-formyl-4-methyl-N-[2-methyl-3-(2-oxoimidazolidin-1-yl)phenyl]thiophene-2-carboxamide. InChIKey: ZJRJCWRBMHUFCK-UHFFFAOYSA-N.
| Molecular formula | C17H17N3O3S |
|---|---|
| Molecular weight | 343.4 g/mol |
| IUPAC name | 5-formyl-4-methyl-N-[2-methyl-3-(2-oxoimidazolidin-1-yl)phenyl]thiophene-2-carboxamide |
| InChIKey | ZJRJCWRBMHUFCK-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=C1)C(=O)NC2=C(C(=CC=C2)N3CCNC3=O)C)C=O |
Computed by PubChem (NCBI)
Synonyms:
SARS-CoV-2 nsp14-IN-3, orb1944462