Products 2241107-60-6
CAS 2241107-60-6 is the registry number for 4-{4-((2S)-2,3-Dihydroxypropyl)piperazin-1-yl}benzoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-[4-[(2S)-2,3-dihydroxypropyl]piperazin-1-yl]benzoic acid (CAS 2241107-60-6) is a chemical compound with the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. IUPAC name: 4-[4-[(2S)-2,3-dihydroxypropyl]piperazin-1-yl]benzoic acid. InChIKey: ZRQKHLBKWYJSMW-ZDUSSCGKSA-N.
| Molecular formula | C14H20N2O4 |
|---|---|
| Molecular weight | 280.32 g/mol |
| IUPAC name | 4-[4-[(2S)-2,3-dihydroxypropyl]piperazin-1-yl]benzoic acid |
| InChIKey | ZRQKHLBKWYJSMW-ZDUSSCGKSA-N |
| SMILES | C1CN(CCN1C[C@@H](CO)O)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)