Products 2241130-93-6

CAS 2241130-93-6 is the registry number for Methyl 8-methoxy-7-azaspiro(3.5)non-7-ene-5-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Methyl 6-methoxy-7-azaspiro[3.5]non-6-ene-9-carboxylate (CAS 2241130-93-6) is a chemical compound with the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. IUPAC name: methyl 6-methoxy-7-azaspiro[3.5]non-6-ene-9-carboxylate. InChIKey: OQTGUCZHZHVWJU-UHFFFAOYSA-N.

Identity
Molecular formulaC11H17NO3
Molecular weight211.26 g/mol
IUPAC namemethyl 6-methoxy-7-azaspiro[3.5]non-6-ene-9-carboxylate
InChIKeyOQTGUCZHZHVWJU-UHFFFAOYSA-N
SMILESCOC1=NCC(C2(C1)CCC2)C(=O)OC

Computed by PubChem (NCBI)