Products 2241144-65-8
CAS 2241144-65-8 is the registry number for 1,2-Dimethyl 4-amino-5-hydroxybenzene-1,2-dicarboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Dimethyl 4-amino-5-hydroxybenzene-1,2-dicarboxylate (CAS 2241144-65-8) is a chemical compound with the molecular formula C10H11NO5 and a molecular weight of 225.20 g/mol. IUPAC name: dimethyl 4-amino-5-hydroxybenzene-1,2-dicarboxylate. InChIKey: WOJCECXZCQJLSG-UHFFFAOYSA-N.
| Molecular formula | C10H11NO5 |
|---|---|
| Molecular weight | 225.20 g/mol |
| IUPAC name | dimethyl 4-amino-5-hydroxybenzene-1,2-dicarboxylate |
| InChIKey | WOJCECXZCQJLSG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1C(=O)OC)O)N |
Computed by PubChem (NCBI)