CAS 2241314-93-0 appears in our catalog under these names: 2-(2,6-Dioxopiperidin-3-yl)-5-(3-(hydroxymethyl)azetidin-1-yl)isoindoline-1,3-dione 95%, Thalidomide-azetidine-C-OH, 98.53%. Offered by: Ambeed, MedChemExpress. Available pack sizes: 50mg, 100mg, 250mg, 1g, 100 mg, 25 mg, 50 mg.
2-(2,6-dioxopiperidin-3-yl)-5-[3-(hydroxymethyl)azetidin-1-yl]isoindole-1,3-dione (CAS 2241314-93-0) is a chemical compound with the molecular formula C17H17N3O5 and a molecular weight of 343.33 g/mol. IUPAC name: 2-(2,6-dioxopiperidin-3-yl)-5-[3-(hydroxymethyl)azetidin-1-yl]isoindole-1,3-dione. InChIKey: FNPPHCWRHBXQJB-UHFFFAOYSA-N.
| Molecular formula | C17H17N3O5 |
|---|---|
| Molecular weight | 343.33 g/mol |
| IUPAC name | 2-(2,6-dioxopiperidin-3-yl)-5-[3-(hydroxymethyl)azetidin-1-yl]isoindole-1,3-dione |
| InChIKey | FNPPHCWRHBXQJB-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C=C(C=C3)N4CC(C4)CO |
Computed by PubChem (NCBI)