CAS 2241583-38-8 is the registry number for 2-(2,6-Dioxopiperidin-3-yl)-4,7-difluoroisoindoline-1,3-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2,6-dioxopiperidin-3-yl)-4,7-difluoroisoindole-1,3-dione (CAS 2241583-38-8) is a chemical compound with the molecular formula C13H8F2N2O4 and a molecular weight of 294.21 g/mol. IUPAC name: 2-(2,6-dioxopiperidin-3-yl)-4,7-difluoroisoindole-1,3-dione. InChIKey: UFGXUQNEFLIIMO-UHFFFAOYSA-N.
| Molecular formula | C13H8F2N2O4 |
|---|---|
| Molecular weight | 294.21 g/mol |
| IUPAC name | 2-(2,6-dioxopiperidin-3-yl)-4,7-difluoroisoindole-1,3-dione |
| InChIKey | UFGXUQNEFLIIMO-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C=CC(=C3C2=O)F)F |
Computed by PubChem (NCBI)