CAS 2768492-86-8 is the registry number for 5-Fluoro-2-(3-fluoro-2,6-dioxopiperidin-3-yl)isoindoline-1,3-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-fluoro-2-(3-fluoro-2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (CAS 2768492-86-8) is a chemical compound with the molecular formula C13H8F2N2O4 and a molecular weight of 294.21 g/mol. IUPAC name: 5-fluoro-2-(3-fluoro-2,6-dioxopiperidin-3-yl)isoindole-1,3-dione. InChIKey: QLVCPORCNSLMML-UHFFFAOYSA-N.
| Molecular formula | C13H8F2N2O4 |
|---|---|
| Molecular weight | 294.21 g/mol |
| IUPAC name | 5-fluoro-2-(3-fluoro-2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| InChIKey | QLVCPORCNSLMML-UHFFFAOYSA-N |
| SMILES | C1CC(C(=O)NC1=O)(N2C(=O)C3=C(C2=O)C=C(C=C3)F)F |
Computed by PubChem (NCBI)