CAS 387882-69-1 appears in our catalog under these names: 4-[(3,4-Difluorophenyl)amino]-3-nitrobenzoic acid, 95%, 4-((3,4-Difluorophenyl)amino)-3-nitrobenzoic acid, 95%, 4-((3,4-Difluorophenyl)amino)-3-nitrobenzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
4-(3,4-difluoroanilino)-3-nitrobenzoic acid (CAS 387882-69-1) is a chemical compound with the molecular formula C13H8F2N2O4 and a molecular weight of 294.21 g/mol. IUPAC name: 4-(3,4-difluoroanilino)-3-nitrobenzoic acid. InChIKey: VCKODVCSCULQLJ-UHFFFAOYSA-N.
| Molecular formula | C13H8F2N2O4 |
|---|---|
| Molecular weight | 294.21 g/mol |
| IUPAC name | 4-(3,4-difluoroanilino)-3-nitrobenzoic acid |
| InChIKey | VCKODVCSCULQLJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)[N+](=O)[O-])NC2=CC(=C(C=C2)F)F |
Computed by PubChem (NCBI)