CAS 2241594-39-6 appears in our catalog under these names: (R)-2-Amino-2-(pyridin-4-yl)ethan-1-ol dihydrochloride, 95%, (R)-2-Amino-2-(pyridin-4-yl)ethanol dihydrochloride, 95%, (R)-2-Amino-2-(pyridin-4-yl)ethan-1-ol dihydrochloride, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
(2R)-2-amino-2-pyridin-4-ylethanol;dihydrochloride (CAS 2241594-39-6) is a chemical compound with the molecular formula C7H12Cl2N2O and a molecular weight of 211.09 g/mol. IUPAC name: (2R)-2-amino-2-pyridin-4-ylethanol;dihydrochloride. InChIKey: XLAMHJAZOJEAEP-KLXURFKVSA-N.
| Molecular formula | C7H12Cl2N2O |
|---|---|
| Molecular weight | 211.09 g/mol |
| IUPAC name | (2R)-2-amino-2-pyridin-4-ylethanol;dihydrochloride |
| InChIKey | XLAMHJAZOJEAEP-KLXURFKVSA-N |
| SMILES | C1=CN=CC=C1[C@H](CO)N.Cl.Cl |
Computed by PubChem (NCBI)