CAS 2241866-92-0 is the registry number for 3-Ethylphenylboronic acid-d5. Offered by: MedChemExpress. Available pack sizes: Get quote.
[3-(1,1,2,2,2-pentadeuterioethyl)phenyl]boronic acid (CAS 2241866-92-0) is a chemical compound with the molecular formula C8H11BO2 and a molecular weight of 155.02 g/mol. IUPAC name: [3-(1,1,2,2,2-pentadeuterioethyl)phenyl]boronic acid. InChIKey: JIMVRUCDZGFJRE-ZBJDZAJPSA-N.
| Molecular formula | C8H11BO2 |
|---|---|
| Molecular weight | 155.02 g/mol |
| IUPAC name | [3-(1,1,2,2,2-pentadeuterioethyl)phenyl]boronic acid |
| InChIKey | JIMVRUCDZGFJRE-ZBJDZAJPSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C1=CC=CC(=C1)B(O)O |
Computed by PubChem (NCBI)