Products 34420-17-2

CAS 34420-17-2 appears in our catalog under these names: 2-Phenyl-1-ethylboronic acid, 95%, 2-Phenylethylboronic Acid (contains varying amounts of Anhydride), Phenethylboronic acid(Contains varying amounts of anhydride), Phenethylboronic acid 97%, PHENETHYLBORONIC ACID. Offered by: Fluorochem, TCI, GLPBio, Ambeed, Sigma-Aldrich. Available pack sizes: 1g, 5g, 10g, 20g, 25g, 100g, 500g.

Structural formula: {0} (CAS {1})

2-phenylethylboronic acid (CAS 34420-17-2) is a chemical compound with the molecular formula C8H11BO2 and a molecular weight of 149.98 g/mol. IUPAC name: 2-phenylethylboronic acid. InChIKey: VPRUMANMDWQMNF-UHFFFAOYSA-N.

Identity
Molecular formulaC8H11BO2
Molecular weight149.98 g/mol
IUPAC name2-phenylethylboronic acid
InChIKeyVPRUMANMDWQMNF-UHFFFAOYSA-N
SMILESB(CCC1=CC=CC=C1)(O)O

Computed by PubChem (NCBI)