Products 90002-36-1

CAS 90002-36-1 appears in our catalog under these names: 2-Ethylphenylboronic acid/ 95+%, 2–Ethylphenylboronic acid, 2-Ethylphenylboronic Acid (contains varying amounts of Anhydride), 2-Ethylphenylboronic acid 97%, 2-Ethylphenylboronic acid, 97%, 97%. Offered by: Chemat, GLPBio, TCI, Ambeed, Fluorochem. Available pack sizes: 1g, 250g, 50g, 5g, 10g, 25g, 100g, 500g.

Structural formula: {0} (CAS {1})

(2-ethylphenyl)boronic acid (CAS 90002-36-1) is a chemical compound with the molecular formula C8H11BO2 and a molecular weight of 149.98 g/mol. IUPAC name: (2-ethylphenyl)boronic acid. InChIKey: QSSPYZOSTJDTTL-UHFFFAOYSA-N.

Identity
Molecular formulaC8H11BO2
Molecular weight149.98 g/mol
IUPAC name(2-ethylphenyl)boronic acid
InChIKeyQSSPYZOSTJDTTL-UHFFFAOYSA-N
SMILESB(C1=CC=CC=C1CC)(O)O

Computed by PubChem (NCBI)