CAS 2241870-58-4 is the registry number for (5,6–bis(methyl–d3)pyridin–3–yl–2,4–d2)boronic acid. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
[2,4-dideuterio-5,6-bis(trideuteriomethyl)-3-pyridinyl]boronic acid (CAS 2241870-58-4) is a chemical compound with the molecular formula C7H10BNO2 and a molecular weight of 159.02 g/mol. IUPAC name: [2,4-dideuterio-5,6-bis(trideuteriomethyl)-3-pyridinyl]boronic acid. InChIKey: BALGFVFIDFKIJM-PIODKIDGSA-N.
| Molecular formula | C7H10BNO2 |
|---|---|
| Molecular weight | 159.02 g/mol |
| IUPAC name | [2,4-dideuterio-5,6-bis(trideuteriomethyl)-3-pyridinyl]boronic acid |
| InChIKey | BALGFVFIDFKIJM-PIODKIDGSA-N |
| SMILES | [2H]C1=C(C(=NC(=C1C([2H])([2H])[2H])C([2H])([2H])[2H])[2H])B(O)O |
Computed by PubChem (NCBI)