Products 2241872-74-0
CAS 2241872-74-0 appears in our catalog under these names: p-Ethylphenol-d9, >95% (HPLC), 4-Ethylphenol-d9. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, 10mg, 50mg, 50 mg, 100 mg, 10 mg.
2,3,5,6-tetradeuterio-4-(1,1,2,2,2-pentadeuterioethyl)phenol (CAS 2241872-74-0) is a chemical compound with the molecular formula C8H10O and a molecular weight of 131.22 g/mol. IUPAC name: 2,3,5,6-tetradeuterio-4-(1,1,2,2,2-pentadeuterioethyl)phenol. InChIKey: HXDOZKJGKXYMEW-SBPQMTJLSA-N.
| Molecular formula | C8H10O |
|---|---|
| Molecular weight | 131.22 g/mol |
| IUPAC name | 2,3,5,6-tetradeuterio-4-(1,1,2,2,2-pentadeuterioethyl)phenol |
| InChIKey | HXDOZKJGKXYMEW-SBPQMTJLSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C([2H])([2H])C([2H])([2H])[2H])[2H])[2H])O)[2H] |
Computed by PubChem (NCBI)
Synonyms:
p-Ethylphenol-d9, 4-(ethyl-d5)phen-2,3,5,6-d4-ol