CAS 340256-40-8 appears in our catalog under these names: 4-Ethylphenol-2,3,5,6-d4,OD, >95% (HPLC), 4-Ethylphenol-2,3,5,6-d4,OD, 98 atom % D, min 98% Chemical Purity, 4–ETHYLPHENOL–2,3,5,6–D4, OD, 4-Ethylphenol-d5. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 100mg, 10mg, 50mg, 1g, 0,5g, 10 mg, 100 mg, 50 mg.
1,2,4,5-tetradeuterio-3-deuteriooxy-6-ethylbenzene (CAS 340256-40-8) is a chemical compound with the molecular formula C8H10O and a molecular weight of 127.19 g/mol. IUPAC name: 1,2,4,5-tetradeuterio-3-deuteriooxy-6-ethylbenzene. InChIKey: HXDOZKJGKXYMEW-VZNXVBLTSA-N.
| Molecular formula | C8H10O |
|---|---|
| Molecular weight | 127.19 g/mol |
| IUPAC name | 1,2,4,5-tetradeuterio-3-deuteriooxy-6-ethylbenzene |
| InChIKey | HXDOZKJGKXYMEW-VZNXVBLTSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1CC)[2H])[2H])O[2H])[2H] |
Computed by PubChem (NCBI)