Products 352431-18-6
CAS 352431-18-6 appears in our catalog under these names: 4-Ethylphenol-d10, 98 atom % D, min 98% Chemical Purity, 4-Ethylphenol-d10, 97.91%. Offered by: CDN, MedChemExpress. Available pack sizes: 0,5g, 0,25g, 10 mg, 5 mg, 50 mg, 25 mg.
1,2,4,5-tetradeuterio-3-deuteriooxy-6-(1,1,2,2,2-pentadeuterioethyl)benzene (CAS 352431-18-6) is a chemical compound with the molecular formula C8H10O and a molecular weight of 132.23 g/mol. IUPAC name: 1,2,4,5-tetradeuterio-3-deuteriooxy-6-(1,1,2,2,2-pentadeuterioethyl)benzene. InChIKey: HXDOZKJGKXYMEW-SQSZMTOTSA-N.
| Molecular formula | C8H10O |
|---|---|
| Molecular weight | 132.23 g/mol |
| IUPAC name | 1,2,4,5-tetradeuterio-3-deuteriooxy-6-(1,1,2,2,2-pentadeuterioethyl)benzene |
| InChIKey | HXDOZKJGKXYMEW-SQSZMTOTSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C([2H])([2H])C([2H])([2H])[2H])[2H])[2H])O[2H])[2H] |
Computed by PubChem (NCBI)