CAS 2241875-86-3 is the registry number for (2–(ethyl–d5)pyridin–4–yl)boronic acid. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
[2-(1,1,2,2,2-pentadeuterioethyl)-4-pyridinyl]boronic acid (CAS 2241875-86-3) is a chemical compound with the molecular formula C7H10BNO2 and a molecular weight of 156.00 g/mol. IUPAC name: [2-(1,1,2,2,2-pentadeuterioethyl)-4-pyridinyl]boronic acid. InChIKey: CBMFWKBCFLYDDG-ZBJDZAJPSA-N.
| Molecular formula | C7H10BNO2 |
|---|---|
| Molecular weight | 156.00 g/mol |
| IUPAC name | [2-(1,1,2,2,2-pentadeuterioethyl)-4-pyridinyl]boronic acid |
| InChIKey | CBMFWKBCFLYDDG-ZBJDZAJPSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C1=NC=CC(=C1)B(O)O |
Computed by PubChem (NCBI)